C18H22N5O3+ — CID 7388415
4-(4-methylpiperazin-4-ium-1-yl)-N-(3-methyl-2-pyridinyl)-3-nitrobenzamide (PubChem CID 7388415) has the molecular formula C18H22N5O3+ and a molecular weight of 356.41 g/mol. Its IUPAC name is 4-(4-methylpiperazin-4-ium-1-yl)-N-(3-methyl-2-pyridinyl)-3-nitrobenzamide.
| Compound Name | 4-(4-methylpiperazin-4-ium-1-yl)-N-(3-methyl-2-pyridinyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 7388415 |
| Molecular Formula | C18H22N5O3+ |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 4-(4-methylpiperazin-4-ium-1-yl)-N-(3-methyl-2-pyridinyl)-3-nitrobenzamide |
| SMILES | Cc1cccnc1NC(=O)c1ccc(N2CC[NH+](C)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H21N5O3/c1-13-4-3-7-19-17(13)20-18(24)14-5-6-15(16(12-14)23(25)26)22-10-8-21(2)9-11-22/h3-7,12H,8-11H2,1-2H3,(H,19,20,24)/p+1 |
| InChIKey | ABTLLNZNERBIFD-UHFFFAOYSA-O |
| XLogP | 0.89 |
| TPSA | 92.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|