C15H10F5N3O4 — CID 9393143
4-ethoxy-3-nitro-N'-(2,3,4,5,6-pentafluorophenyl)benzohydrazide (PubChem CID 9393143) has the molecular formula C15H10F5N3O4 and a molecular weight of 391.25 g/mol. Its IUPAC name is 4-ethoxy-3-nitro-N'-(2,3,4,5,6-pentafluorophenyl)benzohydrazide.
| Compound Name | 4-ethoxy-3-nitro-N'-(2,3,4,5,6-pentafluorophenyl)benzohydrazide |
|---|---|
| PubChem CID | 9393143 |
| Molecular Formula | C15H10F5N3O4 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 4-ethoxy-3-nitro-N'-(2,3,4,5,6-pentafluorophenyl)benzohydrazide |
| SMILES | CCOc1ccc(C(=O)NNc2c(F)c(F)c(F)c(F)c2F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H10F5N3O4/c1-2-27-8-4-3-6(5-7(8)23(25)26)15(24)22-21-14-12(19)10(17)9(16)11(18)13(14)20/h3-5,21H,2H2,1H3,(H,22,24) |
| InChIKey | OVLIEQFXSZOIHE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|