C13H20ClN3O4 — CID 120827071
4-ethoxy-N-[2-(methylamino)propyl]-3-nitrobenzamide;hydrochloride (PubChem CID 120827071) has the molecular formula C13H20ClN3O4 and a molecular weight of 317.77 g/mol. Its IUPAC name is 4-ethoxy-N-[2-(methylamino)propyl]-3-nitrobenzamide;hydrochloride.
| Compound Name | 4-ethoxy-N-[2-(methylamino)propyl]-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 120827071 |
| Molecular Formula | C13H20ClN3O4 |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 4-ethoxy-N-[2-(methylamino)propyl]-3-nitrobenzamide;hydrochloride |
| SMILES | CCOc1ccc(C(=O)NCC(C)NC)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C13H19N3O4.ClH/c1-4-20-12-6-5-10(7-11(12)16(18)19)13(17)15-8-9(2)14-3;/h5-7,9,14H,4,8H2,1-3H3,(H,15,17);1H |
| InChIKey | MURLTVQXMWQCSL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|