C16H25N3O3S — CID 120829692
N-[2-(methylamino)propyl]-4-(3-methylbutylsulfanyl)-3-nitrobenzamide (PubChem CID 120829692) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is N-[2-(methylamino)propyl]-4-(3-methylbutylsulfanyl)-3-nitrobenzamide.
| Compound Name | N-[2-(methylamino)propyl]-4-(3-methylbutylsulfanyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 120829692 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[2-(methylamino)propyl]-4-(3-methylbutylsulfanyl)-3-nitrobenzamide |
| SMILES | CNC(C)CNC(=O)c1ccc(SCCC(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H25N3O3S/c1-11(2)7-8-23-15-6-5-13(9-14(15)19(21)22)16(20)18-10-12(3)17-4/h5-6,9,11-12,17H,7-8,10H2,1-4H3,(H,18,20) |
| InChIKey | FZQVWSIJUPHSLS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|