C15H23N3O3S — CID 120506655
N-[(2S)-1-aminopropan-2-yl]-4-(3-methylbutylsulfanyl)-3-nitrobenzamide (PubChem CID 120506655) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is N-[(2S)-1-aminopropan-2-yl]-4-(3-methylbutylsulfanyl)-3-nitrobenzamide.
| Compound Name | N-[(2S)-1-aminopropan-2-yl]-4-(3-methylbutylsulfanyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 120506655 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-[(2S)-1-aminopropan-2-yl]-4-(3-methylbutylsulfanyl)-3-nitrobenzamide |
| SMILES | CC(C)CCSc1ccc(C(=O)N[C@@H](C)CN)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H23N3O3S/c1-10(2)6-7-22-14-5-4-12(8-13(14)18(20)21)15(19)17-11(3)9-16/h4-5,8,10-11H,6-7,9,16H2,1-3H3,(H,17,19)/t11-/m0/s1 |
| InChIKey | WAROOTKEDPFRCW-NSHDSACASA-N |
| XLogP | 2.81 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|