C16H26ClN3O3S — CID 119582987
N-(1-aminopropan-2-yl)-N-methyl-4-(3-methylbutylsulfanyl)-3-nitrobenzamide;hydrochloride (PubChem CID 119582987) has the molecular formula C16H26ClN3O3S and a molecular weight of 375.92 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-N-methyl-4-(3-methylbutylsulfanyl)-3-nitrobenzamide;hydrochloride.
| Compound Name | N-(1-aminopropan-2-yl)-N-methyl-4-(3-methylbutylsulfanyl)-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119582987 |
| Molecular Formula | C16H26ClN3O3S |
| Molecular Weight | 375.92 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-(1-aminopropan-2-yl)-N-methyl-4-(3-methylbutylsulfanyl)-3-nitrobenzamide;hydrochloride |
| SMILES | CC(C)CCSc1ccc(C(=O)N(C)C(C)CN)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C16H25N3O3S.ClH/c1-11(2)7-8-23-15-6-5-13(9-14(15)19(21)22)16(20)18(4)12(3)10-17;/h5-6,9,11-12H,7-8,10,17H2,1-4H3;1H |
| InChIKey | AHFPBEDIFHWOPV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.92 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|