C18H22N2O4S — CID 112761073
N-(furan-2-ylmethyl)-N-methyl-4-(3-methylbutylsulfanyl)-3-nitrobenzamide (PubChem CID 112761073) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-methyl-4-(3-methylbutylsulfanyl)-3-nitrobenzamide.
| Compound Name | N-(furan-2-ylmethyl)-N-methyl-4-(3-methylbutylsulfanyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 112761073 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-methyl-4-(3-methylbutylsulfanyl)-3-nitrobenzamide |
| SMILES | CC(C)CCSc1ccc(C(=O)N(C)Cc2ccco2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N2O4S/c1-13(2)8-10-25-17-7-6-14(11-16(17)20(22)23)18(21)19(3)12-15-5-4-9-24-15/h4-7,9,11,13H,8,10,12H2,1-3H3 |
| InChIKey | GGUQTXWBRBWYBS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 76.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|