C16H26ClN3O3S — CID 119506710
N-[2-(ethylamino)ethyl]-4-(3-methylbutylsulfanyl)-3-nitrobenzamide;hydrochloride (PubChem CID 119506710) has the molecular formula C16H26ClN3O3S and a molecular weight of 375.92 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-4-(3-methylbutylsulfanyl)-3-nitrobenzamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-4-(3-methylbutylsulfanyl)-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119506710 |
| Molecular Formula | C16H26ClN3O3S |
| Molecular Weight | 375.92 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-4-(3-methylbutylsulfanyl)-3-nitrobenzamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1ccc(SCCC(C)C)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C16H25N3O3S.ClH/c1-4-17-8-9-18-16(20)13-5-6-15(14(11-13)19(21)22)23-10-7-12(2)3;/h5-6,11-12,17H,4,7-10H2,1-3H3,(H,18,20);1H |
| InChIKey | BXFNFBWMJZARQQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.92 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|