C21H26N4O5S2 — CID 56503643
N-cyclopropyl-4-[2-[4-(3-methylbutylsulfanyl)-3-nitrobenzoyl]hydrazinyl]benzenesulfonamide (PubChem CID 56503643) has the molecular formula C21H26N4O5S2 and a molecular weight of 478.60 g/mol. Its IUPAC name is N-cyclopropyl-4-[2-[4-(3-methylbutylsulfanyl)-3-nitrobenzoyl]hydrazinyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-4-[2-[4-(3-methylbutylsulfanyl)-3-nitrobenzoyl]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56503643 |
| Molecular Formula | C21H26N4O5S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | N-cyclopropyl-4-[2-[4-(3-methylbutylsulfanyl)-3-nitrobenzoyl]hydrazinyl]benzenesulfonamide |
| SMILES | CC(C)CCSc1ccc(C(=O)NNc2ccc(S(=O)(=O)NC3CC3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H26N4O5S2/c1-14(2)11-12-31-20-10-3-15(13-19(20)25(27)28)21(26)23-22-16-6-8-18(9-7-16)32(29,30)24-17-4-5-17/h3,6-10,13-14,17,22,24H,4-5,11-12H2,1-2H3,(H,23,26) |
| InChIKey | HCYXIZNBFPDZMU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|