C17H20N4O3S2 — CID 56503137
N-cyclopropyl-4-[2-(2-ethylsulfanylpyridine-4-carbonyl)hydrazinyl]benzenesulfonamide (PubChem CID 56503137) has the molecular formula C17H20N4O3S2 and a molecular weight of 392.51 g/mol. Its IUPAC name is N-cyclopropyl-4-[2-(2-ethylsulfanylpyridine-4-carbonyl)hydrazinyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-4-[2-(2-ethylsulfanylpyridine-4-carbonyl)hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56503137 |
| Molecular Formula | C17H20N4O3S2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | N-cyclopropyl-4-[2-(2-ethylsulfanylpyridine-4-carbonyl)hydrazinyl]benzenesulfonamide |
| SMILES | CCSc1cc(C(=O)NNc2ccc(S(=O)(=O)NC3CC3)cc2)ccn1 |
| InChI | InChI=1S/C17H20N4O3S2/c1-2-25-16-11-12(9-10-18-16)17(22)20-19-13-5-7-15(8-6-13)26(23,24)21-14-3-4-14/h5-11,14,19,21H,2-4H2,1H3,(H,20,22) |
| InChIKey | XOOSNXLMPQHSNG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|