C19H18FN3O3S2 — CID 56503522
N-cyclopropyl-4-[2-(5-fluoro-3-methyl-1-benzothiophene-2-carbonyl)hydrazinyl]benzenesulfonamide (PubChem CID 56503522) has the molecular formula C19H18FN3O3S2 and a molecular weight of 419.50 g/mol. Its IUPAC name is N-cyclopropyl-4-[2-(5-fluoro-3-methyl-1-benzothiophene-2-carbonyl)hydrazinyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-4-[2-(5-fluoro-3-methyl-1-benzothiophene-2-carbonyl)hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56503522 |
| Molecular Formula | C19H18FN3O3S2 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | N-cyclopropyl-4-[2-(5-fluoro-3-methyl-1-benzothiophene-2-carbonyl)hydrazinyl]benzenesulfonamide |
| SMILES | Cc1c(C(=O)NNc2ccc(S(=O)(=O)NC3CC3)cc2)sc2ccc(F)cc12 |
| InChI | InChI=1S/C19H18FN3O3S2/c1-11-16-10-12(20)2-9-17(16)27-18(11)19(24)22-21-13-5-7-15(8-6-13)28(25,26)23-14-3-4-14/h2,5-10,14,21,23H,3-4H2,1H3,(H,22,24) |
| InChIKey | WGTIVPKPQRSYNB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|