C19H17FN2O4S2 — CID 167769744
N-[5-(cyclopropylsulfamoyl)-2-hydroxyphenyl]-6-fluoro-3-methyl-1-benzothiophene-2-carboxamide (PubChem CID 167769744) has the molecular formula C19H17FN2O4S2 and a molecular weight of 420.49 g/mol. Its IUPAC name is N-[5-(cyclopropylsulfamoyl)-2-hydroxyphenyl]-6-fluoro-3-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-[5-(cyclopropylsulfamoyl)-2-hydroxyphenyl]-6-fluoro-3-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 167769744 |
| Molecular Formula | C19H17FN2O4S2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | N-[5-(cyclopropylsulfamoyl)-2-hydroxyphenyl]-6-fluoro-3-methyl-1-benzothiophene-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cc(S(=O)(=O)NC3CC3)ccc2O)sc2cc(F)ccc12 |
| InChI | InChI=1S/C19H17FN2O4S2/c1-10-14-6-2-11(20)8-17(14)27-18(10)19(24)21-15-9-13(5-7-16(15)23)28(25,26)22-12-3-4-12/h2,5-9,12,22-23H,3-4H2,1H3,(H,21,24) |
| InChIKey | YLKYCMSEMJCXBC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|