C16H11ClFNO2S — CID 16573611
3-chloro-6-fluoro-N-(2-hydroxy-4-methylphenyl)-1-benzothiophene-2-carboxamide (PubChem CID 16573611) has the molecular formula C16H11ClFNO2S and a molecular weight of 335.79 g/mol. Its IUPAC name is 3-chloro-6-fluoro-N-(2-hydroxy-4-methylphenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-6-fluoro-N-(2-hydroxy-4-methylphenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 16573611 |
| Molecular Formula | C16H11ClFNO2S |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 3-chloro-6-fluoro-N-(2-hydroxy-4-methylphenyl)-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2sc3cc(F)ccc3c2Cl)c(O)c1 |
| InChI | InChI=1S/C16H11ClFNO2S/c1-8-2-5-11(12(20)6-8)19-16(21)15-14(17)10-4-3-9(18)7-13(10)22-15/h2-7,20H,1H3,(H,19,21) |
| InChIKey | UMCBBMXHFXKAEO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|