C16H10ClF2NOS — CID 16546479
3-chloro-6-fluoro-N-(2-fluoro-5-methylphenyl)-1-benzothiophene-2-carboxamide (PubChem CID 16546479) has the molecular formula C16H10ClF2NOS and a molecular weight of 337.78 g/mol. Its IUPAC name is 3-chloro-6-fluoro-N-(2-fluoro-5-methylphenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-6-fluoro-N-(2-fluoro-5-methylphenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 16546479 |
| Molecular Formula | C16H10ClF2NOS |
| Molecular Weight | 337.78 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 3-chloro-6-fluoro-N-(2-fluoro-5-methylphenyl)-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(F)c(NC(=O)c2sc3cc(F)ccc3c2Cl)c1 |
| InChI | InChI=1S/C16H10ClF2NOS/c1-8-2-5-11(19)12(6-8)20-16(21)15-14(17)10-4-3-9(18)7-13(10)22-15/h2-7H,1H3,(H,20,21) |
| InChIKey | QZSGXYJMUDTDMI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.78 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |