C15H7Cl2FINOS — CID 2214579
3,6-dichloro-N-(2-fluoro-4-iodophenyl)-1-benzothiophene-2-carboxamide (PubChem CID 2214579) has the molecular formula C15H7Cl2FINOS and a molecular weight of 466.10 g/mol. Its IUPAC name is 3,6-dichloro-N-(2-fluoro-4-iodophenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-(2-fluoro-4-iodophenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 2214579 |
| Molecular Formula | C15H7Cl2FINOS |
| Molecular Weight | 466.10 g/mol |
| Exact Mass | 464.87 |
| IUPAC Name | 3,6-dichloro-N-(2-fluoro-4-iodophenyl)-1-benzothiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1F)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C15H7Cl2FINOS/c16-7-1-3-9-12(5-7)22-14(13(9)17)15(21)20-11-4-2-8(19)6-10(11)18/h1-6H,(H,20,21) |
| InChIKey | DNNIOBSXJZNXJO-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.10 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|