C15H10Cl2N2OS — CID 91687360
N-(2-aminophenyl)-3,6-dichloro-1-benzothiophene-2-carboxamide (PubChem CID 91687360) has the molecular formula C15H10Cl2N2OS and a molecular weight of 337.23 g/mol. Its IUPAC name is N-(2-aminophenyl)-3,6-dichloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-3,6-dichloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 91687360 |
| Molecular Formula | C15H10Cl2N2OS |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | N-(2-aminophenyl)-3,6-dichloro-1-benzothiophene-2-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C15H10Cl2N2OS/c16-8-5-6-9-12(7-8)21-14(13(9)17)15(20)19-11-4-2-1-3-10(11)18/h1-7H,18H2,(H,19,20) |
| InChIKey | YYDVNSHHWNXMNS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|