C17H8Cl2F3IN2OS2 — CID 17317044
3,6-dichloro-N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 17317044) has the molecular formula C17H8Cl2F3IN2OS2 and a molecular weight of 575.20 g/mol. Its IUPAC name is 3,6-dichloro-N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17317044 |
| Molecular Formula | C17H8Cl2F3IN2OS2 |
| Molecular Weight | 575.20 g/mol |
| Exact Mass | 573.85 |
| IUPAC Name | 3,6-dichloro-N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(I)cc1C(F)(F)F)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C17H8Cl2F3IN2OS2/c18-7-1-3-9-12(5-7)28-14(13(9)19)15(26)25-16(27)24-11-4-2-8(23)6-10(11)17(20,21)22/h1-6H,(H2,24,25,26,27) |
| InChIKey | ARNUDRTXMZXFKT-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.20 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|