C17H11Cl3N2OS2 — CID 4009957
3,6-dichloro-N-[(5-chloro-2-methylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 4009957) has the molecular formula C17H11Cl3N2OS2 and a molecular weight of 429.78 g/mol. Its IUPAC name is 3,6-dichloro-N-[(5-chloro-2-methylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[(5-chloro-2-methylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4009957 |
| Molecular Formula | C17H11Cl3N2OS2 |
| Molecular Weight | 429.78 g/mol |
| Exact Mass | 427.94 |
| IUPAC Name | 3,6-dichloro-N-[(5-chloro-2-methylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=S)NC(=O)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C17H11Cl3N2OS2/c1-8-2-3-9(18)6-12(8)21-17(24)22-16(23)15-14(20)11-5-4-10(19)7-13(11)25-15/h2-7H,1H3,(H2,21,22,23,24) |
| InChIKey | UCFDSUNMWMQDBK-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.78 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|