C16H7BrCl2F2N2OS2 — CID 3902545
N-[(2-bromo-4,6-difluorophenyl)carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide (PubChem CID 3902545) has the molecular formula C16H7BrCl2F2N2OS2 and a molecular weight of 496.19 g/mol. Its IUPAC name is N-[(2-bromo-4,6-difluorophenyl)carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(2-bromo-4,6-difluorophenyl)carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 3902545 |
| Molecular Formula | C16H7BrCl2F2N2OS2 |
| Molecular Weight | 496.19 g/mol |
| Exact Mass | 493.85 |
| IUPAC Name | N-[(2-bromo-4,6-difluorophenyl)carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1c(F)cc(F)cc1Br)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C16H7BrCl2F2N2OS2/c17-9-4-7(20)5-10(21)13(9)22-16(25)23-15(24)14-12(19)8-2-1-6(18)3-11(8)26-14/h1-5H,(H2,22,23,24,25) |
| InChIKey | CDXSJRIEPYIAKC-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.19 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|