C21H19Cl2N3OS2 — CID 17109749
3,6-dichloro-N-[(2-piperidin-1-ylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 17109749) has the molecular formula C21H19Cl2N3OS2 and a molecular weight of 464.44 g/mol. Its IUPAC name is 3,6-dichloro-N-[(2-piperidin-1-ylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[(2-piperidin-1-ylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17109749 |
| Molecular Formula | C21H19Cl2N3OS2 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | 3,6-dichloro-N-[(2-piperidin-1-ylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccccc1N1CCCCC1)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C21H19Cl2N3OS2/c22-13-8-9-14-17(12-13)29-19(18(14)23)20(27)25-21(28)24-15-6-2-3-7-16(15)26-10-4-1-5-11-26/h2-3,6-9,12H,1,4-5,10-11H2,(H2,24,25,27,28) |
| InChIKey | FOALONNOYOVFIF-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|