C20H16Cl3N3O2S2 — CID 4032854
3,6-dichloro-N-[(3-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 4032854) has the molecular formula C20H16Cl3N3O2S2 and a molecular weight of 500.86 g/mol. Its IUPAC name is 3,6-dichloro-N-[(3-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[(3-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4032854 |
| Molecular Formula | C20H16Cl3N3O2S2 |
| Molecular Weight | 500.86 g/mol |
| Exact Mass | 498.97 |
| IUPAC Name | 3,6-dichloro-N-[(3-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc(Cl)c1N1CCOCC1)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C20H16Cl3N3O2S2/c21-11-4-5-12-15(10-11)30-18(16(12)23)19(27)25-20(29)24-14-3-1-2-13(22)17(14)26-6-8-28-9-7-26/h1-5,10H,6-9H2,(H2,24,25,27,29) |
| InChIKey | CARNNEINTJDXOF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.86 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|