C18H16ClN5O2S2 — CID 17098480
N-[(3-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide (PubChem CID 17098480) has the molecular formula C18H16ClN5O2S2 and a molecular weight of 433.95 g/mol. Its IUPAC name is N-[(3-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide.
| Compound Name | N-[(3-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17098480 |
| Molecular Formula | C18H16ClN5O2S2 |
| Molecular Weight | 433.95 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | N-[(3-chloro-2-morpholin-4-ylphenyl)carbamothioyl]-2,1,3-benzothiadiazole-5-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc(Cl)c1N1CCOCC1)c1ccc2nsnc2c1 |
| InChI | InChI=1S/C18H16ClN5O2S2/c19-12-2-1-3-14(16(12)24-6-8-26-9-7-24)20-18(27)21-17(25)11-4-5-13-15(10-11)23-28-22-13/h1-5,10H,6-9H2,(H2,20,21,25,27) |
| InChIKey | KRLNPUAVCNCRPS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.95 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|