C19H11ClF3IN2O2S — CID 3915278
5-(3-chlorophenyl)-N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 3915278) has the molecular formula C19H11ClF3IN2O2S and a molecular weight of 550.73 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(3-chlorophenyl)-N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3915278 |
| Molecular Formula | C19H11ClF3IN2O2S |
| Molecular Weight | 550.73 g/mol |
| Exact Mass | 549.92 |
| IUPAC Name | 5-(3-chlorophenyl)-N-[[4-iodo-2-(trifluoromethyl)phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(I)cc1C(F)(F)F)c1ccc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C19H11ClF3IN2O2S/c20-11-3-1-2-10(8-11)15-6-7-16(28-15)17(27)26-18(29)25-14-5-4-12(24)9-13(14)19(21,22)23/h1-9H,(H2,25,26,27,29) |
| InChIKey | YOODVHKTBHJZON-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.73 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|