C17H14ClNO4S2 — CID 31618494
3-chloro-N-(5-ethylsulfonyl-2-hydroxyphenyl)-1-benzothiophene-2-carboxamide (PubChem CID 31618494) has the molecular formula C17H14ClNO4S2 and a molecular weight of 395.89 g/mol. Its IUPAC name is 3-chloro-N-(5-ethylsulfonyl-2-hydroxyphenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-(5-ethylsulfonyl-2-hydroxyphenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 31618494 |
| Molecular Formula | C17H14ClNO4S2 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 3-chloro-N-(5-ethylsulfonyl-2-hydroxyphenyl)-1-benzothiophene-2-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)c2sc3ccccc3c2Cl)c1 |
| InChI | InChI=1S/C17H14ClNO4S2/c1-2-25(22,23)10-7-8-13(20)12(9-10)19-17(21)16-15(18)11-5-3-4-6-14(11)24-16/h3-9,20H,2H2,1H3,(H,19,21) |
| InChIKey | SFZGOXYWAGKDLF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|