C16H15N3O4S — CID 31618688
N-(5-ethylsulfonyl-2-hydroxyphenyl)-1H-indazole-3-carboxamide (PubChem CID 31618688) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is N-(5-ethylsulfonyl-2-hydroxyphenyl)-1H-indazole-3-carboxamide.
| Compound Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 31618688 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-(5-ethylsulfonyl-2-hydroxyphenyl)-1H-indazole-3-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)c2n[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C16H15N3O4S/c1-2-24(22,23)10-7-8-14(20)13(9-10)17-16(21)15-11-5-3-4-6-12(11)18-19-15/h3-9,20H,2H2,1H3,(H,17,21)(H,18,19) |
| InChIKey | IUGAMYFFDZBFRY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|