C15H11N3O4 — CID 170858293
4-hydroxy-3-(1H-indazole-3-carbonylamino)benzoic acid (PubChem CID 170858293) has the molecular formula C15H11N3O4 and a molecular weight of 297.27 g/mol. Its IUPAC name is 4-hydroxy-3-(1H-indazole-3-carbonylamino)benzoic acid.
| Compound Name | 4-hydroxy-3-(1H-indazole-3-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 170858293 |
| Molecular Formula | C15H11N3O4 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 4-hydroxy-3-(1H-indazole-3-carbonylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(O)c(NC(=O)c2n[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C15H11N3O4/c19-12-6-5-8(15(21)22)7-11(12)16-14(20)13-9-3-1-2-4-10(9)17-18-13/h1-7,19H,(H,16,20)(H,17,18)(H,21,22) |
| InChIKey | MTZKQHRCZJJLTB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|