C18H19F2N3O4S — CID 56502755
N-cyclopropyl-4-[2-[2-(3,4-difluorophenoxy)propanoyl]hydrazinyl]benzenesulfonamide (PubChem CID 56502755) has the molecular formula C18H19F2N3O4S and a molecular weight of 411.43 g/mol. Its IUPAC name is N-cyclopropyl-4-[2-[2-(3,4-difluorophenoxy)propanoyl]hydrazinyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-4-[2-[2-(3,4-difluorophenoxy)propanoyl]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56502755 |
| Molecular Formula | C18H19F2N3O4S |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | N-cyclopropyl-4-[2-[2-(3,4-difluorophenoxy)propanoyl]hydrazinyl]benzenesulfonamide |
| SMILES | CC(Oc1ccc(F)c(F)c1)C(=O)NNc1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C18H19F2N3O4S/c1-11(27-14-6-9-16(19)17(20)10-14)18(24)22-21-12-4-7-15(8-5-12)28(25,26)23-13-2-3-13/h4-11,13,21,23H,2-3H2,1H3,(H,22,24) |
| InChIKey | WRTCQZYCYDNKAA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|