C22H27ClN4O4S — CID 56504410
4-chloro-N-[1-[2-[4-(cyclopropylsulfamoyl)phenyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 56504410) has the molecular formula C22H27ClN4O4S and a molecular weight of 479.00 g/mol. Its IUPAC name is 4-chloro-N-[1-[2-[4-(cyclopropylsulfamoyl)phenyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1-[2-[4-(cyclopropylsulfamoyl)phenyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 56504410 |
| Molecular Formula | C22H27ClN4O4S |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 4-chloro-N-[1-[2-[4-(cyclopropylsulfamoyl)phenyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CCC(C)C(NC(=O)c1ccc(Cl)cc1)C(=O)NNc1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C22H27ClN4O4S/c1-3-14(2)20(24-21(28)15-4-6-16(23)7-5-15)22(29)26-25-17-10-12-19(13-11-17)32(30,31)27-18-8-9-18/h4-7,10-14,18,20,25,27H,3,8-9H2,1-2H3,(H,24,28)(H,26,29) |
| InChIKey | KYIALARUQKHGNO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|