C21H22N4O3S3 — CID 56503129
N-cyclopropyl-4-[2-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzoyl]hydrazinyl]benzenesulfonamide (PubChem CID 56503129) has the molecular formula C21H22N4O3S3 and a molecular weight of 474.63 g/mol. Its IUPAC name is N-cyclopropyl-4-[2-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzoyl]hydrazinyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-4-[2-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzoyl]hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56503129 |
| Molecular Formula | C21H22N4O3S3 |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | N-cyclopropyl-4-[2-[4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzoyl]hydrazinyl]benzenesulfonamide |
| SMILES | Cc1csc(SCc2ccc(C(=O)NNc3ccc(S(=O)(=O)NC4CC4)cc3)cc2)n1 |
| InChI | InChI=1S/C21H22N4O3S3/c1-14-12-29-21(22-14)30-13-15-2-4-16(5-3-15)20(26)24-23-17-8-10-19(11-9-17)31(27,28)25-18-6-7-18/h2-5,8-12,18,23,25H,6-7,13H2,1H3,(H,24,26) |
| InChIKey | GLHIFRYEFDRWHK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|