C22H29N3OS2 — CID 56569543
N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzamide (PubChem CID 56569543) has the molecular formula C22H29N3OS2 and a molecular weight of 415.63 g/mol. Its IUPAC name is N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzamide.
| Compound Name | N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 56569543 |
| Molecular Formula | C22H29N3OS2 |
| Molecular Weight | 415.63 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | N-[1-(3-methylbut-2-enyl)piperidin-4-yl]-4-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]benzamide |
| SMILES | CC(C)=CCN1CCC(NC(=O)c2ccc(CSc3nc(C)cs3)cc2)CC1 |
| InChI | InChI=1S/C22H29N3OS2/c1-16(2)8-11-25-12-9-20(10-13-25)24-21(26)19-6-4-18(5-7-19)15-28-22-23-17(3)14-27-22/h4-8,14,20H,9-13,15H2,1-3H3,(H,24,26) |
| InChIKey | XNSVWLOMSDOVOQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|