C16H19N5O3S — CID 26121096
N-cyclopropyl-3-[[(4,6-dimethylpyrimidin-2-yl)amino]carbamoyl]benzenesulfonamide (PubChem CID 26121096) has the molecular formula C16H19N5O3S and a molecular weight of 361.43 g/mol. Its IUPAC name is N-cyclopropyl-3-[[(4,6-dimethylpyrimidin-2-yl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-3-[[(4,6-dimethylpyrimidin-2-yl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 26121096 |
| Molecular Formula | C16H19N5O3S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-cyclopropyl-3-[[(4,6-dimethylpyrimidin-2-yl)amino]carbamoyl]benzenesulfonamide |
| SMILES | Cc1cc(C)nc(NNC(=O)c2cccc(S(=O)(=O)NC3CC3)c2)n1 |
| InChI | InChI=1S/C16H19N5O3S/c1-10-8-11(2)18-16(17-10)20-19-15(22)12-4-3-5-14(9-12)25(23,24)21-13-6-7-13/h3-5,8-9,13,21H,6-7H2,1-2H3,(H,19,22)(H,17,18,20) |
| InChIKey | DPEVJEWPBKPNRA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|