C17H17N3O5S — CID 27698212
N-cyclopropyl-3-[[(2-hydroxybenzoyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 27698212) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is N-cyclopropyl-3-[[(2-hydroxybenzoyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-cyclopropyl-3-[[(2-hydroxybenzoyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 27698212 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-cyclopropyl-3-[[(2-hydroxybenzoyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | O=C(NNC(=O)c1ccccc1O)c1cccc(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C17H17N3O5S/c21-15-7-2-1-6-14(15)17(23)19-18-16(22)11-4-3-5-13(10-11)26(24,25)20-12-8-9-12/h1-7,10,12,20-21H,8-9H2,(H,18,22)(H,19,23) |
| InChIKey | JQXAJMVDXLGJAI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|