C17H19N3O3S — CID 87041364
3-(cyclopropylsulfamoyl)-N-[(6-methyl-2-pyridinyl)methyl]benzamide (PubChem CID 87041364) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 3-(cyclopropylsulfamoyl)-N-[(6-methyl-2-pyridinyl)methyl]benzamide.
| Compound Name | 3-(cyclopropylsulfamoyl)-N-[(6-methyl-2-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 87041364 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 3-(cyclopropylsulfamoyl)-N-[(6-methyl-2-pyridinyl)methyl]benzamide |
| SMILES | Cc1cccc(CNC(=O)c2cccc(S(=O)(=O)NC3CC3)c2)n1 |
| InChI | InChI=1S/C17H19N3O3S/c1-12-4-2-6-15(19-12)11-18-17(21)13-5-3-7-16(10-13)24(22,23)20-14-8-9-14/h2-7,10,14,20H,8-9,11H2,1H3,(H,18,21) |
| InChIKey | SHYHJERQKQIGFG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |