C22H27N3O3S — CID 56503432
(3-anilinopyrrolidin-1-yl)-[4-(3-methylbutylsulfanyl)-3-nitrophenyl]methanone (PubChem CID 56503432) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is (3-anilinopyrrolidin-1-yl)-[4-(3-methylbutylsulfanyl)-3-nitrophenyl]methanone.
| Compound Name | (3-anilinopyrrolidin-1-yl)-[4-(3-methylbutylsulfanyl)-3-nitrophenyl]methanone |
|---|---|
| PubChem CID | 56503432 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (3-anilinopyrrolidin-1-yl)-[4-(3-methylbutylsulfanyl)-3-nitrophenyl]methanone |
| SMILES | CC(C)CCSc1ccc(C(=O)N2CCC(Nc3ccccc3)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H27N3O3S/c1-16(2)11-13-29-21-9-8-17(14-20(21)25(27)28)22(26)24-12-10-19(15-24)23-18-6-4-3-5-7-18/h3-9,14,16,19,23H,10-13,15H2,1-2H3 |
| InChIKey | QGGMYNGAACLTIT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|