C17H25N3O3S — CID 119632528
[2-(aminomethyl)pyrrolidin-1-yl]-[4-(3-methylbutylsulfanyl)-3-nitrophenyl]methanone (PubChem CID 119632528) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is [2-(aminomethyl)pyrrolidin-1-yl]-[4-(3-methylbutylsulfanyl)-3-nitrophenyl]methanone.
| Compound Name | [2-(aminomethyl)pyrrolidin-1-yl]-[4-(3-methylbutylsulfanyl)-3-nitrophenyl]methanone |
|---|---|
| PubChem CID | 119632528 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | [2-(aminomethyl)pyrrolidin-1-yl]-[4-(3-methylbutylsulfanyl)-3-nitrophenyl]methanone |
| SMILES | CC(C)CCSc1ccc(C(=O)N2CCCC2CN)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H25N3O3S/c1-12(2)7-9-24-16-6-5-13(10-15(16)20(22)23)17(21)19-8-3-4-14(19)11-18/h5-6,10,12,14H,3-4,7-9,11,18H2,1-2H3 |
| InChIKey | RGYXHCVQNXXPQP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|