C19H19N3O4S — CID 86858118
N-[2-(1,3-benzothiazol-2-yl)propyl]-4-ethoxy-3-nitrobenzamide (PubChem CID 86858118) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)propyl]-4-ethoxy-3-nitrobenzamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)propyl]-4-ethoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 86858118 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)propyl]-4-ethoxy-3-nitrobenzamide |
| SMILES | CCOc1ccc(C(=O)NCC(C)c2nc3ccccc3s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19N3O4S/c1-3-26-16-9-8-13(10-15(16)22(24)25)18(23)20-11-12(2)19-21-14-6-4-5-7-17(14)27-19/h4-10,12H,3,11H2,1-2H3,(H,20,23) |
| InChIKey | MFNISYOTMOHCFL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|