C16H14ClN3OS — CID 86858161
N-[2-(1,3-benzothiazol-2-yl)propyl]-6-chloropyridine-3-carboxamide (PubChem CID 86858161) has the molecular formula C16H14ClN3OS and a molecular weight of 331.83 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)propyl]-6-chloropyridine-3-carboxamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)propyl]-6-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 86858161 |
| Molecular Formula | C16H14ClN3OS |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)propyl]-6-chloropyridine-3-carboxamide |
| SMILES | CC(CNC(=O)c1ccc(Cl)nc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H14ClN3OS/c1-10(16-20-12-4-2-3-5-13(12)22-16)8-19-15(21)11-6-7-14(17)18-9-11/h2-7,9-10H,8H2,1H3,(H,19,21) |
| InChIKey | NMSDMWBQIBEQHF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|