C16H14ClN3OS — CID 9406160
N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-6-chloro-N-methylpyridine-3-carboxamide (PubChem CID 9406160) has the molecular formula C16H14ClN3OS and a molecular weight of 331.83 g/mol. Its IUPAC name is N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-6-chloro-N-methylpyridine-3-carboxamide.
| Compound Name | N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-6-chloro-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 9406160 |
| Molecular Formula | C16H14ClN3OS |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | N-[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-6-chloro-N-methylpyridine-3-carboxamide |
| SMILES | C[C@@H](c1nc2ccccc2s1)N(C)C(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H14ClN3OS/c1-10(15-19-12-5-3-4-6-13(12)22-15)20(2)16(21)11-7-8-14(17)18-9-11/h3-10H,1-2H3/t10-/m0/s1 |
| InChIKey | LDPKREDNBOCWTH-JTQLQIEISA-N |
| XLogP | 4.18 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|