C21H20N4OS — CID 86860575
N-[2-(1,3-benzothiazol-2-yl)propyl]-4-(imidazol-1-ylmethyl)benzamide (PubChem CID 86860575) has the molecular formula C21H20N4OS and a molecular weight of 376.49 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)propyl]-4-(imidazol-1-ylmethyl)benzamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)propyl]-4-(imidazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 86860575 |
| Molecular Formula | C21H20N4OS |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)propyl]-4-(imidazol-1-ylmethyl)benzamide |
| SMILES | CC(CNC(=O)c1ccc(Cn2ccnc2)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H20N4OS/c1-15(21-24-18-4-2-3-5-19(18)27-21)12-23-20(26)17-8-6-16(7-9-17)13-25-11-10-22-14-25/h2-11,14-15H,12-13H2,1H3,(H,23,26) |
| InChIKey | LTJGWRQWPYHDQV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |