C18H25Cl2N5O3 — CID 120826536
N-[2-(methylamino)propyl]-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide;dihydrochloride (PubChem CID 120826536) has the molecular formula C18H25Cl2N5O3 and a molecular weight of 430.34 g/mol. Its IUPAC name is N-[2-(methylamino)propyl]-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide;dihydrochloride.
| Compound Name | N-[2-(methylamino)propyl]-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 120826536 |
| Molecular Formula | C18H25Cl2N5O3 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | N-[2-(methylamino)propyl]-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide;dihydrochloride |
| SMILES | CNC(C)CNC(=O)c1ccc(NC(C)c2ccccn2)c([N+](=O)[O-])c1.Cl.Cl |
| InChI | InChI=1S/C18H23N5O3.2ClH/c1-12(19-3)11-21-18(24)14-7-8-16(17(10-14)23(25)26)22-13(2)15-6-4-5-9-20-15;;/h4-10,12-13,19,22H,11H2,1-3H3,(H,21,24);2*1H |
| InChIKey | IIABYUCLMYSKBX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|