C19H22N4O5 — CID 119368767
(2R)-3-methyl-2-[[3-nitro-4-(1-pyridin-2-ylethylamino)benzoyl]amino]butanoic acid (PubChem CID 119368767) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is (2R)-3-methyl-2-[[3-nitro-4-(1-pyridin-2-ylethylamino)benzoyl]amino]butanoic acid.
| Compound Name | (2R)-3-methyl-2-[[3-nitro-4-(1-pyridin-2-ylethylamino)benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119368767 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (2R)-3-methyl-2-[[3-nitro-4-(1-pyridin-2-ylethylamino)benzoyl]amino]butanoic acid |
| SMILES | CC(Nc1ccc(C(=O)N[C@@H](C(=O)O)C(C)C)cc1[N+](=O)[O-])c1ccccn1 |
| InChI | InChI=1S/C19H22N4O5/c1-11(2)17(19(25)26)22-18(24)13-7-8-15(16(10-13)23(27)28)21-12(3)14-6-4-5-9-20-14/h4-12,17,21H,1-3H3,(H,22,24)(H,25,26)/t12?,17-/m1/s1 |
| InChIKey | BZSRNTZEMMJFSW-RGUGMKFQSA-N |
| XLogP | 3.00 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|