C19H25Cl2N5O3 — CID 119613099
N-(2-amino-1-cyclopropylethyl)-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide;dihydrochloride (PubChem CID 119613099) has the molecular formula C19H25Cl2N5O3 and a molecular weight of 442.35 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide;dihydrochloride.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119613099 |
| Molecular Formula | C19H25Cl2N5O3 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide;dihydrochloride |
| SMILES | CC(Nc1ccc(C(=O)NC(CN)C2CC2)cc1[N+](=O)[O-])c1ccccn1.Cl.Cl |
| InChI | InChI=1S/C19H23N5O3.2ClH/c1-12(15-4-2-3-9-21-15)22-16-8-7-14(10-18(16)24(26)27)19(25)23-17(11-20)13-5-6-13;;/h2-4,7-10,12-13,17,22H,5-6,11,20H2,1H3,(H,23,25);2*1H |
| InChIKey | FWYPUJHOHJHWJI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|