C20H27Cl2N5O3 — CID 119460161
3-nitro-N-(piperidin-3-ylmethyl)-4-(1-pyridin-2-ylethylamino)benzamide;dihydrochloride (PubChem CID 119460161) has the molecular formula C20H27Cl2N5O3 and a molecular weight of 456.37 g/mol. Its IUPAC name is 3-nitro-N-(piperidin-3-ylmethyl)-4-(1-pyridin-2-ylethylamino)benzamide;dihydrochloride.
| Compound Name | 3-nitro-N-(piperidin-3-ylmethyl)-4-(1-pyridin-2-ylethylamino)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119460161 |
| Molecular Formula | C20H27Cl2N5O3 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 3-nitro-N-(piperidin-3-ylmethyl)-4-(1-pyridin-2-ylethylamino)benzamide;dihydrochloride |
| SMILES | CC(Nc1ccc(C(=O)NCC2CCCNC2)cc1[N+](=O)[O-])c1ccccn1.Cl.Cl |
| InChI | InChI=1S/C20H25N5O3.2ClH/c1-14(17-6-2-3-10-22-17)24-18-8-7-16(11-19(18)25(27)28)20(26)23-13-15-5-4-9-21-12-15;;/h2-3,6-8,10-11,14-15,21,24H,4-5,9,12-13H2,1H3,(H,23,26);2*1H |
| InChIKey | XGDGYMODMQXATF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|