C21H27Cl2N5O3 — CID 119455434
N-(8-azabicyclo[3.2.1]octan-3-yl)-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide;dihydrochloride (PubChem CID 119455434) has the molecular formula C21H27Cl2N5O3 and a molecular weight of 468.39 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide;dihydrochloride.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119455434 |
| Molecular Formula | C21H27Cl2N5O3 |
| Molecular Weight | 468.39 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide;dihydrochloride |
| SMILES | CC(Nc1ccc(C(=O)NC2CC3CCC(C2)N3)cc1[N+](=O)[O-])c1ccccn1.Cl.Cl |
| InChI | InChI=1S/C21H25N5O3.2ClH/c1-13(18-4-2-3-9-22-18)23-19-8-5-14(10-20(19)26(28)29)21(27)25-17-11-15-6-7-16(12-17)24-15;;/h2-5,8-10,13,15-17,23-24H,6-7,11-12H2,1H3,(H,25,27);2*1H |
| InChIKey | SDPOMEPVCGQEGE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|