C24H23FN4O3 — CID 97256272
N-[(1S)-7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-3-nitro-4-[[(1R)-1-pyridin-2-ylethyl]amino]benzamide (PubChem CID 97256272) has the molecular formula C24H23FN4O3 and a molecular weight of 434.47 g/mol. Its IUPAC name is N-[(1S)-7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-3-nitro-4-[[(1R)-1-pyridin-2-ylethyl]amino]benzamide.
| Compound Name | N-[(1S)-7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-3-nitro-4-[[(1R)-1-pyridin-2-ylethyl]amino]benzamide |
|---|---|
| PubChem CID | 97256272 |
| Molecular Formula | C24H23FN4O3 |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[(1S)-7-fluoro-1,2,3,4-tetrahydronaphthalen-1-yl]-3-nitro-4-[[(1R)-1-pyridin-2-ylethyl]amino]benzamide |
| SMILES | C[C@@H](Nc1ccc(C(=O)N[C@H]2CCCc3ccc(F)cc32)cc1[N+](=O)[O-])c1ccccn1 |
| InChI | InChI=1S/C24H23FN4O3/c1-15(20-6-2-3-12-26-20)27-22-11-9-17(13-23(22)29(31)32)24(30)28-21-7-4-5-16-8-10-18(25)14-19(16)21/h2-3,6,8-15,21,27H,4-5,7H2,1H3,(H,28,30)/t15-,21+/m1/s1 |
| InChIKey | XITTYGFZRBGCNP-VFNWGFHPSA-N |
| XLogP | 5.11 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|