C20H25N5O4 — CID 55996649
N-(2-morpholin-4-ylethyl)-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide (PubChem CID 55996649) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide |
|---|---|
| PubChem CID | 55996649 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-3-nitro-4-(1-pyridin-2-ylethylamino)benzamide |
| SMILES | CC(Nc1ccc(C(=O)NCCN2CCOCC2)cc1[N+](=O)[O-])c1ccccn1 |
| InChI | InChI=1S/C20H25N5O4/c1-15(17-4-2-3-7-21-17)23-18-6-5-16(14-19(18)25(27)28)20(26)22-8-9-24-10-12-29-13-11-24/h2-7,14-15,23H,8-13H2,1H3,(H,22,26) |
| InChIKey | RNQLPNNBUJBEJI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|