C22H19N5O6 — CID 55997944
N'-[3-nitro-4-(1-pyridin-2-ylethylamino)benzoyl]-1,3-benzodioxole-5-carbohydrazide (PubChem CID 55997944) has the molecular formula C22H19N5O6 and a molecular weight of 449.42 g/mol. Its IUPAC name is N'-[3-nitro-4-(1-pyridin-2-ylethylamino)benzoyl]-1,3-benzodioxole-5-carbohydrazide.
| Compound Name | N'-[3-nitro-4-(1-pyridin-2-ylethylamino)benzoyl]-1,3-benzodioxole-5-carbohydrazide |
|---|---|
| PubChem CID | 55997944 |
| Molecular Formula | C22H19N5O6 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | N'-[3-nitro-4-(1-pyridin-2-ylethylamino)benzoyl]-1,3-benzodioxole-5-carbohydrazide |
| SMILES | CC(Nc1ccc(C(=O)NNC(=O)c2ccc3c(c2)OCO3)cc1[N+](=O)[O-])c1ccccn1 |
| InChI | InChI=1S/C22H19N5O6/c1-13(16-4-2-3-9-23-16)24-17-7-5-14(10-18(17)27(30)31)21(28)25-26-22(29)15-6-8-19-20(11-15)33-12-32-19/h2-11,13,24H,12H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | PHRBDFVZKABNGM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 144.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|