C24H32N2O4 — CID 16757353
3-[4-(1-adamantylcarbamoylamino)cyclohexyl]oxybenzoic acid (PubChem CID 16757353) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is 3-[4-(1-adamantylcarbamoylamino)cyclohexyl]oxybenzoic acid.
| Compound Name | 3-[4-(1-adamantylcarbamoylamino)cyclohexyl]oxybenzoic acid |
|---|---|
| PubChem CID | 16757353 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 3-[4-(1-adamantylcarbamoylamino)cyclohexyl]oxybenzoic acid |
| SMILES | O=C(NC1CCC(Oc2cccc(C(=O)O)c2)CC1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H32N2O4/c27-22(28)18-2-1-3-21(11-18)30-20-6-4-19(5-7-20)25-23(29)26-24-12-15-8-16(13-24)10-17(9-15)14-24/h1-3,11,15-17,19-20H,4-10,12-14H2,(H,27,28)(H2,25,26,29) |
| InChIKey | MURDWSCWZJZGCX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |