3-[3-(1-adamantylcarbamoylamino)phenoxy]benzoic acid

C24H26N2O4 — CID 25014864

IUPAC3-[3-(1-adamantylcarbamoylamino)phenoxy]benzoic acid
SMILESO=C(Nc1cccc(Oc2cccc(C(=O)O)c2)c1)NC12CC3CC(CC(C3)C1)C2
InChIInChI=1S/C24H26N2O4/c27-22(28)18-3-1-5-20(10-18)30-21-6-2-4-19(11-21)25-23(29)26-24-12-15-7-16(13-24)9-17(8-15)14-24/h1-6,10-11,15-17H,7-9,12-14H2,(H,27,28)(H2,25,26,29)
InChIKeyLVTRJKRTYCPCCH-UHFFFAOYSA-N
MW406.48 g/mol
LogP5.27
Rot. Bonds5

About 3-[3-(1-adamantylcarbamoylamino)phenoxy]benzoic acid

3-[3-(1-adamantylcarbamoylamino)phenoxy]benzoic acid (PubChem CID 25014864) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 3-[3-(1-adamantylcarbamoylamino)phenoxy]benzoic acid.

Molecular Properties

Compound Name3-[3-(1-adamantylcarbamoylamino)phenoxy]benzoic acid
PubChem CID25014864
Molecular FormulaC24H26N2O4
Molecular Weight406.48 g/mol
Exact Mass406.19
IUPAC Name3-[3-(1-adamantylcarbamoylamino)phenoxy]benzoic acid
SMILESO=C(Nc1cccc(Oc2cccc(C(=O)O)c2)c1)NC12CC3CC(CC(C3)C1)C2
InChIInChI=1S/C24H26N2O4/c27-22(28)18-3-1-5-20(10-18)30-21-6-2-4-19(11-21)25-23(29)26-24-12-15-7-16(13-24)9-17(8-15)14-24/h1-6,10-11,15-17H,7-9,12-14H2,(H,27,28)(H2,25,26,29)
InChIKeyLVTRJKRTYCPCCH-UHFFFAOYSA-N
XLogP5.27
TPSA87.66 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms30
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500406.48
LogP ≤ 55.27
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-[3-(1-adamantylcarbamoylamino)phenoxy]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3-(1-adamantylcarbamoylamino)phenoxy]benzoic acid?
The IUPAC name of 3-[3-(1-adamantylcarbamoylamino)phenoxy]benzoic acid (CID 25014864) is 3-[3-(1-adamantylcarbamoylamino)phenoxy]benzoic acid.
What is the SMILES notation for 3-[3-(1-adamantylcarbamoylamino)phenoxy]benzoic acid?
The canonical SMILES for 3-[3-(1-adamantylcarbamoylamino)phenoxy]benzoic acid is O=C(Nc1cccc(Oc2cccc(C(=O)O)c2)c1)NC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 3-[3-(1-adamantylcarbamoylamino)phenoxy]benzoic acid?
The InChIKey is LVTRJKRTYCPCCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N2O4/c27-22(28)18-3-1-5-20(10-18)30-21-6-2-4-19(11-21)25-23(29)26-24-12-15-7-16(13-24)9-17(8-15)14-24/h1-6,10-11,15-17H,7-9,12-14H2,(H,27,28)(H2,25,26,29).
What are the key properties of 3-[3-(1-adamantylcarbamoylamino)phenoxy]benzoic acid?
3-[3-(1-adamantylcarbamoylamino)phenoxy]benzoic acid has a molecular weight of 406.48 g/mol, XLogP of 5.27, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(1-adamantylcarbamoylamino)phenoxy]benzoic acid is sourced from PubChem (CID 25014864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).