C24H35N3O3 — CID 25014955
1-(1-adamantyl)-3-[3-(3-morpholin-4-ylpropoxy)phenyl]urea (PubChem CID 25014955) has the molecular formula C24H35N3O3 and a molecular weight of 413.56 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[3-(3-morpholin-4-ylpropoxy)phenyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[3-(3-morpholin-4-ylpropoxy)phenyl]urea |
|---|---|
| PubChem CID | 25014955 |
| Molecular Formula | C24H35N3O3 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | 1-(1-adamantyl)-3-[3-(3-morpholin-4-ylpropoxy)phenyl]urea |
| SMILES | O=C(Nc1cccc(OCCCN2CCOCC2)c1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H35N3O3/c28-23(26-24-15-18-11-19(16-24)13-20(12-18)17-24)25-21-3-1-4-22(14-21)30-8-2-5-27-6-9-29-10-7-27/h1,3-4,14,18-20H,2,5-13,15-17H2,(H2,25,26,28) |
| InChIKey | DNZKUFQHNRWFLR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|